C20H26O8S — CID 135021310
[(3R,6R)-3,4-diacetyloxy-5-benzylsulfanyl-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 135021310) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is [(3R,6R)-3,4-diacetyloxy-5-benzylsulfanyl-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,4-diacetyloxy-5-benzylsulfanyl-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135021310 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [(3R,6R)-3,4-diacetyloxy-5-benzylsulfanyl-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1SCc1ccccc1 |
| InChI | InChI=1S/C20H26O8S/c1-12(21)25-10-16-17(26-13(2)22)18(27-14(3)23)19(20(24-4)28-16)29-11-15-8-6-5-7-9-15/h5-9,16-20H,10-11H2,1-4H3/t16?,17-,18?,19?,20-/m1/s1 |
| InChIKey | QNYRUNKIOBXGGB-SHYKQCSQSA-N |
| XLogP | 2.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|