C21H23NO3 — CID 135021427
tert-butyl (3S,6R)-3,6-diphenyl-3,6-dihydrooxazine-2-carboxylate (PubChem CID 135021427) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl (3S,6R)-3,6-diphenyl-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | tert-butyl (3S,6R)-3,6-diphenyl-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 135021427 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl (3S,6R)-3,6-diphenyl-3,6-dihydrooxazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1O[C@@H](c2ccccc2)C=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-21(2,3)24-20(23)22-18(16-10-6-4-7-11-16)14-15-19(25-22)17-12-8-5-9-13-17/h4-15,18-19H,1-3H3/t18-,19+/m0/s1 |
| InChIKey | KQXGPTFHMCENRO-RBUKOAKNSA-N |
| XLogP | 5.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|