C18H34O4Si — CID 135021643
(3Z,5S,6R,12S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-12-methyl-1-oxacyclododec-3-en-2-one (PubChem CID 135021643) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (3Z,5S,6R,12S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-12-methyl-1-oxacyclododec-3-en-2-one.
| Compound Name | (3Z,5S,6R,12S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-12-methyl-1-oxacyclododec-3-en-2-one |
|---|---|
| PubChem CID | 135021643 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (3Z,5S,6R,12S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-12-methyl-1-oxacyclododec-3-en-2-one |
| SMILES | C[C@H]1CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C\C(=O)O1 |
| InChI | InChI=1S/C18H34O4Si/c1-14-10-8-7-9-11-16(15(19)12-13-17(20)21-14)22-23(5,6)18(2,3)4/h12-16,19H,7-11H2,1-6H3/b13-12-/t14-,15-,16+/m0/s1 |
| InChIKey | RYVDCALUOQJJQS-KNGOCNRGSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|