About 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine
3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine (PubChem CID 135021668) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine.
Molecular Properties
| Compound Name | 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine |
| PubChem CID | 135021668 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine |
| SMILES | CCCCC/N=C1\Sc2ccccc2CN1C |
| InChI | InChI=1S/C14H20N2S/c1-3-4-7-10-15-14-16(2)11-12-8-5-6-9-13(12)17-14/h5-6,8-9H,3-4,7,10-11H2,1-2H3/b15-14- |
| InChIKey | WMILPAXWHOWTGQ-PFONDFGASA-N |
| XLogP | 3.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine?
The IUPAC name of 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine (CID 135021668) is 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine.
What is the SMILES notation for 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine?
The canonical SMILES for 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine is CCCCC/N=C1\Sc2ccccc2CN1C.
What is the InChIKey of 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine?
The InChIKey is WMILPAXWHOWTGQ-PFONDFGASA-N. The full InChI is InChI=1S/C14H20N2S/c1-3-4-7-10-15-14-16(2)11-12-8-5-6-9-13(12)17-14/h5-6,8-9H,3-4,7,10-11H2,1-2H3/b15-14-.
What are the key properties of 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine?
3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine has a molecular weight of 248.39 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-pentyl-4H-1,3-benzothiazin-2-imine is sourced from PubChem (CID 135021668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).