C31H64O5Si3 — CID 135021778
(E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-3-methyl-4-trimethylsilylbut-3-en-1-ol (PubChem CID 135021778) has the molecular formula C31H64O5Si3 and a molecular weight of 601.11 g/mol. Its IUPAC name is (E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-3-methyl-4-trimethylsilylbut-3-en-1-ol.
| Compound Name | (E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-3-methyl-4-trimethylsilylbut-3-en-1-ol |
|---|---|
| PubChem CID | 135021778 |
| Molecular Formula | C31H64O5Si3 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | (E,1R)-1-[(1R,3S,4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-3-methoxy-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-1-yl]-3-methyl-4-trimethylsilylbut-3-en-1-ol |
| SMILES | CC[Si](CC)(CC)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1[C@@H](OC)O[C@]2([C@H](O)C/C(C)=C/[Si](C)(C)C)[C@H]1CC2(C)C |
| InChI | InChI=1S/C31H64O5Si3/c1-16-39(17-2,18-3)34-21-25(36-38(14,15)29(5,6)7)27-24-20-30(8,9)31(24,35-28(27)33-10)26(32)19-23(4)22-37(11,12)13/h22,24-28,32H,16-21H2,1-15H3/b23-22+/t24-,25+,26+,27+,28-,31-/m0/s1 |
| InChIKey | MZWAXAHYYWLVOV-ZFMZMYEMSA-N |
| XLogP | 8.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|