C11H14O6 — CID 135021802
(1R,2R,6R,8R,11S)-4,4-dimethyl-3,5,7,10,14-pentaoxatetracyclo[6.6.0.01,11.02,6]tetradecan-13-one (PubChem CID 135021802) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (1R,2R,6R,8R,11S)-4,4-dimethyl-3,5,7,10,14-pentaoxatetracyclo[6.6.0.01,11.02,6]tetradecan-13-one.
| Compound Name | (1R,2R,6R,8R,11S)-4,4-dimethyl-3,5,7,10,14-pentaoxatetracyclo[6.6.0.01,11.02,6]tetradecan-13-one |
|---|---|
| PubChem CID | 135021802 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (1R,2R,6R,8R,11S)-4,4-dimethyl-3,5,7,10,14-pentaoxatetracyclo[6.6.0.01,11.02,6]tetradecan-13-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CO[C@H]4CC(=O)O[C@]43[C@H]2O1 |
| InChI | InChI=1S/C11H14O6/c1-10(2)16-8-9(17-10)14-6-4-13-5-3-7(12)15-11(5,6)8/h5-6,8-9H,3-4H2,1-2H3/t5-,6+,8-,9+,11+/m0/s1 |
| InChIKey | HXZBFUNGKNFHFD-KHBMLBSESA-N |
| XLogP | -0.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |