C12H16O7 — CID 135021807
(1R,5S,9R,11R,15R)-8-hydroxy-13,13-dimethyl-2,6,10,12,14-pentaoxatetracyclo[7.6.0.01,5.011,15]pentadecan-3-one (PubChem CID 135021807) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is (1R,5S,9R,11R,15R)-8-hydroxy-13,13-dimethyl-2,6,10,12,14-pentaoxatetracyclo[7.6.0.01,5.011,15]pentadecan-3-one.
| Compound Name | (1R,5S,9R,11R,15R)-8-hydroxy-13,13-dimethyl-2,6,10,12,14-pentaoxatetracyclo[7.6.0.01,5.011,15]pentadecan-3-one |
|---|---|
| PubChem CID | 135021807 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (1R,5S,9R,11R,15R)-8-hydroxy-13,13-dimethyl-2,6,10,12,14-pentaoxatetracyclo[7.6.0.01,5.011,15]pentadecan-3-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(O)CO[C@H]4CC(=O)O[C@]43[C@H]2O1 |
| InChI | InChI=1S/C12H16O7/c1-11(2)18-9-10(19-11)16-8-5(13)4-15-6-3-7(14)17-12(6,8)9/h5-6,8-10,13H,3-4H2,1-2H3/t5?,6-,8+,9-,10+,12+/m0/s1 |
| InChIKey | HPCMUIGAYSLKDO-DNVGACMVSA-N |
| XLogP | -0.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |