C20H32O2 — CID 135022027
(1S,7S,8R,11R,12S)-7-hydroxy-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradec-3-en-5-one (PubChem CID 135022027) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,7S,8R,11R,12S)-7-hydroxy-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradec-3-en-5-one.
| Compound Name | (1S,7S,8R,11R,12S)-7-hydroxy-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradec-3-en-5-one |
|---|---|
| PubChem CID | 135022027 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,7S,8R,11R,12S)-7-hydroxy-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradec-3-en-5-one |
| SMILES | CC1=C2C[C@]3(C)CC[C@@H](C(C)C)[C@H]3CC[C@@H](C)[C@@]2(O)CC1=O |
| InChI | InChI=1S/C20H32O2/c1-12(2)15-8-9-19(5)10-17-14(4)18(21)11-20(17,22)13(3)6-7-16(15)19/h12-13,15-16,22H,6-11H2,1-5H3/t13-,15+,16-,19+,20+/m1/s1 |
| InChIKey | UHLQGMSCOUMZFU-OPLZCHAUSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |