C18H22O6 — CID 135022191
dimethyl (1R,2R,6S,7S)-1-cyclopropyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate (PubChem CID 135022191) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is dimethyl (1R,2R,6S,7S)-1-cyclopropyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (1R,2R,6S,7S)-1-cyclopropyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 135022191 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | dimethyl (1R,2R,6S,7S)-1-cyclopropyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C3CC3)C=C[C@@H]1[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H22O6/c1-17(2)23-13-10-7-8-18(9-5-6-9,14(13)24-17)12(16(20)22-4)11(10)15(19)21-3/h7-10,13-14H,5-6H2,1-4H3/t10-,13-,14-,18-/m0/s1 |
| InChIKey | XVYVTIZPEMVUSG-PCPUYYKTSA-N |
| XLogP | 1.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|