C30H58O4SSi3 — CID 135022445
[(3S,4R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylsulfanyloxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 135022445) has the molecular formula C30H58O4SSi3 and a molecular weight of 599.12 g/mol. Its IUPAC name is [(3S,4R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylsulfanyloxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,4R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylsulfanyloxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135022445 |
| Molecular Formula | C30H58O4SSi3 |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [(3S,4R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylsulfanyloxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1O[C@H](Sc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O4SSi3/c1-28(2,3)36(10,11)31-22-25-27(34-38(14,15)30(7,8)9)24(33-37(12,13)29(4,5)6)21-26(32-25)35-23-19-17-16-18-20-23/h16-20,24-27H,21-22H2,1-15H3/t24-,25?,26-,27-/m1/s1 |
| InChIKey | ASCQVNZHFSEURR-IOALDKMNSA-N |
| XLogP | 9.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|