C25H22N2O4S2 — CID 135022477
4-methyl-N-[4-(4-methylphenyl)sulfonyl-2-pyridin-2-ylphenyl]benzenesulfonamide (PubChem CID 135022477) has the molecular formula C25H22N2O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-methyl-N-[4-(4-methylphenyl)sulfonyl-2-pyridin-2-ylphenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-(4-methylphenyl)sulfonyl-2-pyridin-2-ylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135022477 |
| Molecular Formula | C25H22N2O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-methyl-N-[4-(4-methylphenyl)sulfonyl-2-pyridin-2-ylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)c3ccc(C)cc3)cc2-c2ccccn2)cc1 |
| InChI | InChI=1S/C25H22N2O4S2/c1-18-6-10-20(11-7-18)32(28,29)22-14-15-25(23(17-22)24-5-3-4-16-26-24)27-33(30,31)21-12-8-19(2)9-13-21/h3-17,27H,1-2H3 |
| InChIKey | GITLRAQIIJEKJS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |