C10H19OSi+ — CID 135022514
4-ethoxypenta-1,2-dien-3-yl(trimethyl)silane (PubChem CID 135022514) has the molecular formula C10H19OSi+ and a molecular weight of 183.35 g/mol. Its IUPAC name is 4-ethoxypenta-1,2-dien-3-yl(trimethyl)silane.
| Compound Name | 4-ethoxypenta-1,2-dien-3-yl(trimethyl)silane |
|---|---|
| PubChem CID | 135022514 |
| Molecular Formula | C10H19OSi+ |
| Molecular Weight | 183.35 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 4-ethoxypenta-1,2-dien-3-yl(trimethyl)silane |
| SMILES | C=C=C(C(C)O[CH+]C)[Si](C)(C)C |
| InChI | InChI=1S/C10H19OSi/c1-7-10(12(4,5)6)9(3)11-8-2/h8-9H,1H2,2-6H3/q+1 |
| InChIKey | IYLJEGXPUSXIDO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|