About 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one
1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one (PubChem CID 135022684) has the molecular formula C35H31N7O
and a molecular weight of 565.68 g/mol. Its IUPAC name is 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one.
Molecular Properties
| Compound Name | 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one |
| PubChem CID | 135022684 |
| Molecular Formula | C35H31N7O |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C1(Cc1cn(Cc2ccccc2)nn1)Cc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C35H31N7O/c43-34-35(20-30-25-40(38-36-30)22-27-12-4-1-5-13-27,21-31-26-41(39-37-31)23-28-14-6-2-7-15-28)32-18-10-11-19-33(32)42(34)24-29-16-8-3-9-17-29/h1-19,25-26H,20-24H2 |
| InChIKey | VKIJHNXWMXIVMN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one?
The IUPAC name of 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one (CID 135022684) is 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one.
What is the SMILES notation for 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one?
The canonical SMILES for 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one is O=C1N(Cc2ccccc2)c2ccccc2C1(Cc1cn(Cc2ccccc2)nn1)Cc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one?
The InChIKey is VKIJHNXWMXIVMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H31N7O/c43-34-35(20-30-25-40(38-36-30)22-27-12-4-1-5-13-27,21-31-26-41(39-37-31)23-28-14-6-2-7-15-28)32-18-10-11-19-33(32)42(34)24-29-16-8-3-9-17-29/h1-19,25-26H,20-24H2.
What are the key properties of 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one?
1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one has a molecular weight of 565.68 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,3-bis[(1-benzyltriazol-4-yl)methyl]indol-2-one is sourced from PubChem (CID 135022684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).