C24H38N2O6 — CID 135022691
methyl 3-[3,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]propanoate (PubChem CID 135022691) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl 3-[3,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]propanoate.
| Compound Name | methyl 3-[3,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 135022691 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | methyl 3-[3,4-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(CCNC(=O)OC(C)(C)C)c(CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H38N2O6/c1-23(2,3)31-21(28)25-14-12-18-10-8-17(9-11-20(27)30-7)16-19(18)13-15-26-22(29)32-24(4,5)6/h8,10,16H,9,11-15H2,1-7H3,(H,25,28)(H,26,29) |
| InChIKey | UIQQZDJBEDHWDM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|