C12H20O2 — CID 135022721
(6Z)-7-butyl-6-methyl-2,3,4,5-tetrahydrooxocin-8-one (PubChem CID 135022721) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (6Z)-7-butyl-6-methyl-2,3,4,5-tetrahydrooxocin-8-one.
| Compound Name | (6Z)-7-butyl-6-methyl-2,3,4,5-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 135022721 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (6Z)-7-butyl-6-methyl-2,3,4,5-tetrahydrooxocin-8-one |
| SMILES | CCCC/C1=C(\C)CCCCOC1=O |
| InChI | InChI=1S/C12H20O2/c1-3-4-8-11-10(2)7-5-6-9-14-12(11)13/h3-9H2,1-2H3/b11-10- |
| InChIKey | HPSQHIOJHYPIKD-KHPPLWFESA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |