C19H22F3NO3 — CID 135022745
(4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 135022745) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135022745 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluorobutan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](CC)C(F)(F)F |
| InChI | InChI=1S/C19H22F3NO3/c1-3-8-15(16(4-2)19(20,21)22)17(24)23-14(12-26-18(23)25)11-13-9-6-5-7-10-13/h3,5-7,9-10,14-16H,1,4,8,11-12H2,2H3/t14-,15-,16+/m0/s1 |
| InChIKey | OHRMTMQRMKYTBJ-HRCADAONSA-N |
| XLogP | 4.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|