C37H40O6 — CID 135022803
(5R,8R)-8,9,10-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decane (PubChem CID 135022803) has the molecular formula C37H40O6 and a molecular weight of 580.72 g/mol. Its IUPAC name is (5R,8R)-8,9,10-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decane.
| Compound Name | (5R,8R)-8,9,10-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135022803 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | (5R,8R)-8,9,10-tris(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decane |
| SMILES | c1ccc(COCC2O[C@]3(CCCO3)C(OCc3ccccc3)C(OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H40O6/c1-5-14-29(15-6-1)24-38-28-33-34(39-25-30-16-7-2-8-17-30)35(40-26-31-18-9-3-10-19-31)36(37(43-33)22-13-23-42-37)41-27-32-20-11-4-12-21-32/h1-12,14-21,33-36H,13,22-28H2/t33?,34-,35?,36?,37-/m1/s1 |
| InChIKey | ISZZXMGYDKYOLP-RABYDFTGSA-N |
| XLogP | 6.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |