About [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate (PubChem CID 135022837) has the molecular formula C24H40O5
and a molecular weight of 408.58 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate.
Molecular Properties
| Compound Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate |
| PubChem CID | 135022837 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate |
| SMILES | CCCCCCCC#CC(=O)CCCCCCCC(=O)OC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H40O5/c1-4-5-6-7-8-10-13-16-21(25)17-14-11-9-12-15-18-23(26)27-19-22-20-28-24(2,3)29-22/h22H,4-12,14-15,17-20H2,1-3H3/t22-/m1/s1 |
| InChIKey | POLHPDHOLFCREJ-JOCHJYFZSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate?
The IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate (CID 135022837) is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate.
What is the SMILES notation for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate?
The canonical SMILES for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate is CCCCCCCC#CC(=O)CCCCCCCC(=O)OC[C@@H]1COC(C)(C)O1.
What is the InChIKey of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate?
The InChIKey is POLHPDHOLFCREJ-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H40O5/c1-4-5-6-7-8-10-13-16-21(25)17-14-11-9-12-15-18-23(26)27-19-22-20-28-24(2,3)29-22/h22H,4-12,14-15,17-20H2,1-3H3/t22-/m1/s1.
What are the key properties of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate?
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate has a molecular weight of 408.58 g/mol, XLogP of 5.34, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 9-oxooctadec-10-ynoate is sourced from PubChem (CID 135022837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).