C18H20F3NO3 — CID 135022845
(4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluoropropan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 135022845) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluoropropan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluoropropan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135022845 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(2R)-1,1,1-trifluoropropan-2-yl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO3/c1-3-7-15(12(2)18(19,20)21)16(23)22-14(11-25-17(22)24)10-13-8-5-4-6-9-13/h3-6,8-9,12,14-15H,1,7,10-11H2,2H3/t12-,14+,15+/m1/s1 |
| InChIKey | USAXPWMBWDPTMH-SNPRPXQTSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|