C17H16F3NO — CID 135022919
N-[(1R,2S)-3,3,3-trifluoro-1,2-diphenylpropyl]acetamide (PubChem CID 135022919) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is N-[(1R,2S)-3,3,3-trifluoro-1,2-diphenylpropyl]acetamide.
| Compound Name | N-[(1R,2S)-3,3,3-trifluoro-1,2-diphenylpropyl]acetamide |
|---|---|
| PubChem CID | 135022919 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[(1R,2S)-3,3,3-trifluoro-1,2-diphenylpropyl]acetamide |
| SMILES | CC(=O)N[C@@H](c1ccccc1)[C@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO/c1-12(22)21-16(14-10-6-3-7-11-14)15(17(18,19)20)13-8-4-2-5-9-13/h2-11,15-16H,1H3,(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | KXJNQERSEAAJGV-HOTGVXAUSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |