C22H48O4Si2 — CID 135022966
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-3-methyloxiran-2-yl]-4-tri(propan-2-yl)silyloxybutan-1-ol (PubChem CID 135022966) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-3-methyloxiran-2-yl]-4-tri(propan-2-yl)silyloxybutan-1-ol.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-3-methyloxiran-2-yl]-4-tri(propan-2-yl)silyloxybutan-1-ol |
|---|---|
| PubChem CID | 135022966 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-3-methyloxiran-2-yl]-4-tri(propan-2-yl)silyloxybutan-1-ol |
| SMILES | CC(C)[Si](OC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)[C@@H]1O[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-15(2)28(16(3)4,17(5)6)24-14-20(19(13-23)21-18(7)25-21)26-27(11,12)22(8,9)10/h15-21,23H,13-14H2,1-12H3/t18-,19-,20-,21+/m0/s1 |
| InChIKey | FVVPNPDYMBZCQV-XSDIEEQYSA-N |
| XLogP | 5.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|