C25H46O5Si — CID 135023110
(3aR,4R,9S,10E,11aS)-9-[tert-butyl(dimethyl)silyl]oxy-4-heptyl-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one (PubChem CID 135023110) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is (3aR,4R,9S,10E,11aS)-9-[tert-butyl(dimethyl)silyl]oxy-4-heptyl-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one.
| Compound Name | (3aR,4R,9S,10E,11aS)-9-[tert-butyl(dimethyl)silyl]oxy-4-heptyl-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
|---|---|
| PubChem CID | 135023110 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (3aR,4R,9S,10E,11aS)-9-[tert-butyl(dimethyl)silyl]oxy-4-heptyl-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
| SMILES | CCCCCCC[C@H]1OC(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)/C=C/[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C25H46O5Si/c1-9-10-11-12-13-14-20-23-21(28-25(5,6)29-23)17-15-19(16-18-22(26)27-20)30-31(7,8)24(2,3)4/h15,17,19-21,23H,9-14,16,18H2,1-8H3/b17-15+/t19-,20-,21+,23-/m1/s1 |
| InChIKey | CDXQDASQYHJBRN-ZMTBLTFVSA-N |
| XLogP | 6.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|