C24H29F3O2 — CID 135023284
(8R,9S,13S)-13-methyl-3-[(E)-6,6,6-trifluorohex-3-enoxy]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 135023284) has the molecular formula C24H29F3O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (8R,9S,13S)-13-methyl-3-[(E)-6,6,6-trifluorohex-3-enoxy]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S)-13-methyl-3-[(E)-6,6,6-trifluorohex-3-enoxy]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 135023284 |
| Molecular Formula | C24H29F3O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (8R,9S,13S)-13-methyl-3-[(E)-6,6,6-trifluorohex-3-enoxy]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCC/C=C/CC(F)(F)F)cc4CC[C@H]3C1CCC2=O |
| InChI | InChI=1S/C24H29F3O2/c1-23-13-11-19-18-8-6-17(29-14-4-2-3-12-24(25,26)27)15-16(18)5-7-20(19)21(23)9-10-22(23)28/h2-3,6,8,15,19-21H,4-5,7,9-14H2,1H3/b3-2+/t19-,20-,21?,23+/m1/s1 |
| InChIKey | ZEWVAASBVFEECQ-GKVRWZDPSA-N |
| XLogP | 6.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|