C24H38O2Si — CID 135023296
(3R,6aR)-3-(2-methylpent-4-en-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 135023296) has the molecular formula C24H38O2Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (3R,6aR)-3-(2-methylpent-4-en-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3R,6aR)-3-(2-methylpent-4-en-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 135023296 |
| Molecular Formula | C24H38O2Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (3R,6aR)-3-(2-methylpent-4-en-2-yl)-4-[2-tri(propan-2-yl)silylethynyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C=CCC(C)(C)[C@H]1OC[C@@H]2CC(=O)C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C21 |
| InChI | InChI=1S/C24H38O2Si/c1-10-12-24(8,9)23-22-19(15-26-23)14-21(25)20(22)11-13-27(16(2)3,17(4)5)18(6)7/h10,16-19,23H,1,12,14-15H2,2-9H3/t19-,23-/m0/s1 |
| InChIKey | BHCZDCAVBNKAIC-CVDCTZTESA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|