C12H18O2 — CID 135023338
4-[(1R)-1-prop-2-ynoxyethyl]hepta-1,6-dien-4-ol (PubChem CID 135023338) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-[(1R)-1-prop-2-ynoxyethyl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[(1R)-1-prop-2-ynoxyethyl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 135023338 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-[(1R)-1-prop-2-ynoxyethyl]hepta-1,6-dien-4-ol |
| SMILES | C#CCO[C@H](C)C(O)(CC=C)CC=C |
| InChI | InChI=1S/C12H18O2/c1-5-8-12(13,9-6-2)11(4)14-10-7-3/h3,5-6,11,13H,1-2,8-10H2,4H3/t11-/m1/s1 |
| InChIKey | AOUXBPYRBFUKPD-LLVKDONJSA-N |
| XLogP | 1.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|