C19H28O2 — CID 135023734
(1R,2R,6R,7R,8R,12E)-3,13-dimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-9-one (PubChem CID 135023734) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R,12E)-3,13-dimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-9-one.
| Compound Name | (1R,2R,6R,7R,8R,12E)-3,13-dimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-9-one |
|---|---|
| PubChem CID | 135023734 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,2R,6R,7R,8R,12E)-3,13-dimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-9-one |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C/C(C)=C\CCC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C19H28O2/c1-11(2)14-9-8-13(4)17-16-10-12(3)6-5-7-15(20)19(21-16)18(14)17/h6,8,11,14,16-19H,5,7,9-10H2,1-4H3/b12-6-/t14-,16-,17-,18-,19+/m1/s1 |
| InChIKey | KJEJPXNFMIDPQH-ZLRHMWQFSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|