C22H38O6Si — CID 135023999
tert-butyl [(2S,3S)-3-[2-[(2S,3S)-3-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methyl carbonate (PubChem CID 135023999) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-[2-[(2S,3S)-3-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2S,3S)-3-[2-[(2S,3S)-3-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 135023999 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | tert-butyl [(2S,3S)-3-[2-[(2S,3S)-3-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@]1(C)O[C@H]1CC[C@@H]1O[C@@]1(C)CCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H38O6Si/c1-20(2,3)28-19(24)25-15-22(5)18(27-22)10-9-17-21(4,26-17)13-11-16(23)12-14-29(6,7)8/h16-18,23H,9-11,13,15H2,1-8H3/t16?,17-,18-,21-,22-/m0/s1 |
| InChIKey | PYPOLVILZGSAGE-PNAXMACTSA-N |
| XLogP | 4.06 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|