C15H19NO4 — CID 135024057
methyl (1R,4aR,10aR)-4a-cyano-2,5-dioxo-3,4,6,7,8,9,10,10a-octahydro-1H-benzo[8]annulene-1-carboxylate (PubChem CID 135024057) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl (1R,4aR,10aR)-4a-cyano-2,5-dioxo-3,4,6,7,8,9,10,10a-octahydro-1H-benzo[8]annulene-1-carboxylate.
| Compound Name | methyl (1R,4aR,10aR)-4a-cyano-2,5-dioxo-3,4,6,7,8,9,10,10a-octahydro-1H-benzo[8]annulene-1-carboxylate |
|---|---|
| PubChem CID | 135024057 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl (1R,4aR,10aR)-4a-cyano-2,5-dioxo-3,4,6,7,8,9,10,10a-octahydro-1H-benzo[8]annulene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)CC[C@@]2(C#N)C(=O)CCCCC[C@H]12 |
| InChI | InChI=1S/C15H19NO4/c1-20-14(19)13-10-5-3-2-4-6-12(18)15(10,9-16)8-7-11(13)17/h10,13H,2-8H2,1H3/t10-,13-,15+/m1/s1 |
| InChIKey | AVWQLCOFDQDAJL-YVLXSGLVSA-N |
| XLogP | 1.80 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|