C15H16O7 — CID 135024277
dimethyl 1-methyl-5,9-dioxo-8-oxatricyclo[5.2.2.02,6]undec-2(6)-ene-10,11-dicarboxylate (PubChem CID 135024277) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is dimethyl 1-methyl-5,9-dioxo-8-oxatricyclo[5.2.2.02,6]undec-2(6)-ene-10,11-dicarboxylate.
| Compound Name | dimethyl 1-methyl-5,9-dioxo-8-oxatricyclo[5.2.2.02,6]undec-2(6)-ene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 135024277 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | dimethyl 1-methyl-5,9-dioxo-8-oxatricyclo[5.2.2.02,6]undec-2(6)-ene-10,11-dicarboxylate |
| SMILES | COC(=O)C1C2OC(=O)C(C)(C3=C2C(=O)CC3)C1C(=O)OC |
| InChI | InChI=1S/C15H16O7/c1-15-6-4-5-7(16)8(6)11(22-14(15)19)9(12(17)20-2)10(15)13(18)21-3/h9-11H,4-5H2,1-3H3 |
| InChIKey | LLEPDYKIXGXGAS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|