C20H21NO3 — CID 135024580
[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenyloxiran-2-yl]-phenylmethanol (PubChem CID 135024580) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is [3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenyloxiran-2-yl]-phenylmethanol.
| Compound Name | [3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenyloxiran-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 135024580 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenyloxiran-2-yl]-phenylmethanol |
| SMILES | CC1(C)COC(C2(c3ccccc3)OC2C(O)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H21NO3/c1-19(2)13-23-18(21-19)20(15-11-7-4-8-12-15)17(24-20)16(22)14-9-5-3-6-10-14/h3-12,16-17,22H,13H2,1-2H3 |
| InChIKey | OVCFZMYPYRQIKS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|