C12H18O3 — CID 135024927
methyl (E)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]prop-2-enoate (PubChem CID 135024927) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135024927 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl (E)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1O[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C12H18O3/c1-14-11(13)8-7-10-12(15-10)9-5-3-2-4-6-9/h7-10,12H,2-6H2,1H3/b8-7+/t10-,12-/m0/s1 |
| InChIKey | QXIPZTBHRYTXOS-HUAGXHDJSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|