C32H28O5 — CID 135025053
5,13-dimethoxy-10-methyl-4,14-bis(phenylmethoxy)tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one (PubChem CID 135025053) has the molecular formula C32H28O5 and a molecular weight of 492.57 g/mol. Its IUPAC name is 5,13-dimethoxy-10-methyl-4,14-bis(phenylmethoxy)tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 5,13-dimethoxy-10-methyl-4,14-bis(phenylmethoxy)tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 135025053 |
| Molecular Formula | C32H28O5 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5,13-dimethoxy-10-methyl-4,14-bis(phenylmethoxy)tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one |
| SMILES | COc1cc2c(C)cc(=O)c3cc(OC)c(OCc4ccccc4)cc3c2cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H28O5/c1-21-14-28(33)27-18-30(35-3)32(37-20-23-12-8-5-9-13-23)17-26(27)25-16-31(29(34-2)15-24(21)25)36-19-22-10-6-4-7-11-22/h4-18H,19-20H2,1-3H3 |
| InChIKey | SJVNEUXOKVVHKV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |