C20H28O3 — CID 135025108
(1'S,2'R,10'R)-2',6'-dimethylspiro[1,3-dioxolane-2,13'-tetracyclo[10.3.1.01,10.02,7]hexadec-6-ene]-8'-one (PubChem CID 135025108) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1'S,2'R,10'R)-2',6'-dimethylspiro[1,3-dioxolane-2,13'-tetracyclo[10.3.1.01,10.02,7]hexadec-6-ene]-8'-one.
| Compound Name | (1'S,2'R,10'R)-2',6'-dimethylspiro[1,3-dioxolane-2,13'-tetracyclo[10.3.1.01,10.02,7]hexadec-6-ene]-8'-one |
|---|---|
| PubChem CID | 135025108 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1'S,2'R,10'R)-2',6'-dimethylspiro[1,3-dioxolane-2,13'-tetracyclo[10.3.1.01,10.02,7]hexadec-6-ene]-8'-one |
| SMILES | CC1=C2C(=O)C[C@H]3CC4C[C@]3(CCC43OCCO3)[C@@]2(C)CCC1 |
| InChI | InChI=1S/C20H28O3/c1-13-4-3-5-18(2)17(13)16(21)11-14-10-15-12-19(14,18)6-7-20(15)22-8-9-23-20/h14-15H,3-12H2,1-2H3/t14-,15?,18+,19+/m1/s1 |
| InChIKey | COKRMFQIAJSUSP-WWSNYEOCSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |