C20H20 — CID 135025142
4a,6b,10a,11,11a,11b,12,12a-octahydroindeno[2,1-a]fluorene (PubChem CID 135025142) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4a,6b,10a,11,11a,11b,12,12a-octahydroindeno[2,1-a]fluorene.
| Compound Name | 4a,6b,10a,11,11a,11b,12,12a-octahydroindeno[2,1-a]fluorene |
|---|---|
| PubChem CID | 135025142 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4a,6b,10a,11,11a,11b,12,12a-octahydroindeno[2,1-a]fluorene |
| SMILES | C1=CC2CC3C(=CC=C4C5C=CC=CC5CC43)C2C=C1 |
| InChI | InChI=1S/C20H20/c1-3-7-15-13(5-1)11-19-17(15)9-10-18-16-8-4-2-6-14(16)12-20(18)19/h1-10,13-16,19-20H,11-12H2 |
| InChIKey | BMGMMFOOAADDNA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |