C17H26O3 — CID 135025280
(3R,3aR,7S,7aR)-3-ethenyl-3a-methyl-7-(oxan-2-yloxy)-2,3,5,6,7,7a-hexahydro-1H-inden-4-one (PubChem CID 135025280) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3R,3aR,7S,7aR)-3-ethenyl-3a-methyl-7-(oxan-2-yloxy)-2,3,5,6,7,7a-hexahydro-1H-inden-4-one.
| Compound Name | (3R,3aR,7S,7aR)-3-ethenyl-3a-methyl-7-(oxan-2-yloxy)-2,3,5,6,7,7a-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 135025280 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3R,3aR,7S,7aR)-3-ethenyl-3a-methyl-7-(oxan-2-yloxy)-2,3,5,6,7,7a-hexahydro-1H-inden-4-one |
| SMILES | C=C[C@H]1CC[C@H]2[C@@H](OC3CCCCO3)CCC(=O)[C@]12C |
| InChI | InChI=1S/C17H26O3/c1-3-12-7-8-13-14(9-10-15(18)17(12,13)2)20-16-6-4-5-11-19-16/h3,12-14,16H,1,4-11H2,2H3/t12-,13-,14-,16?,17+/m0/s1 |
| InChIKey | DRJJIBJOVDNYKM-WZPWUNBUSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|