About N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide
N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide (PubChem CID 135025454) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide.
Molecular Properties
| Compound Name | N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide |
| PubChem CID | 135025454 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide |
| SMILES | COC(OC)C(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C10H19NO4/c1-14-10(15-2)9(13)11-7-3-5-8(12)6-4-7/h7-8,10,12H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | DEKYAXSXCDGBGO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide?
The IUPAC name of N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide (CID 135025454) is N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide.
What is the SMILES notation for N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide?
The canonical SMILES for N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide is COC(OC)C(=O)NC1CCC(O)CC1.
What is the InChIKey of N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide?
The InChIKey is DEKYAXSXCDGBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-14-10(15-2)9(13)11-7-3-5-8(12)6-4-7/h7-8,10,12H,3-6H2,1-2H3,(H,11,13).
What are the key properties of N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide?
N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide has a molecular weight of 217.26 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxycyclohexyl)-2,2-dimethoxyacetamide is sourced from PubChem (CID 135025454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).