C17H28O6 — CID 135025617
[(1S,2R,5S,6R,7S,8R,10R)-5,7-dihydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-hydroxyacetate (PubChem CID 135025617) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(1S,2R,5S,6R,7S,8R,10R)-5,7-dihydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,5S,6R,7S,8R,10R)-5,7-dihydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 135025617 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(1S,2R,5S,6R,7S,8R,10R)-5,7-dihydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-hydroxyacetate |
| SMILES | CC(C)[C@@]12C[C@@H](OC(=O)CO)[C@@](C)(O1)[C@@H]1CC[C@](C)(O)[C@H]1[C@@H]2O |
| InChI | InChI=1S/C17H28O6/c1-9(2)17-7-11(22-12(19)8-18)16(4,23-17)10-5-6-15(3,21)13(10)14(17)20/h9-11,13-14,18,20-21H,5-8H2,1-4H3/t10-,11-,13-,14+,15+,16+,17-/m1/s1 |
| InChIKey | JTFDBYUJEPRADF-ZTYPPFRNSA-N |
| XLogP | 0.62 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |