C27H56O4Si2 — CID 135025621
(2S)-2-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]but-3-en-2-ol (PubChem CID 135025621) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is (2S)-2-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]but-3-en-2-ol.
| Compound Name | (2S)-2-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 135025621 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | (2S)-2-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]but-3-en-2-ol |
| SMILES | C=C[C@](C)(O)[C@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C27H56O4Si2/c1-13-26(11,28)24-17-19-27(12,31-32(14-2,15-3)16-4)25(30-24)18-20-29-33(21(5)6,22(7)8)23(9)10/h13,21-25,28H,1,14-20H2,2-12H3/t24-,25-,26+,27-/m1/s1 |
| InChIKey | BNNPCTNQMVAUQU-JVYGEBFASA-N |
| XLogP | 7.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|