C20H38O3Si — CID 135025648
[(2Z)-2-[(2S,3S,6R)-6-methyl-3-propan-2-yl-2-trimethylsilyloxycyclohexylidene]ethyl] 2,2-dimethylpropanoate (PubChem CID 135025648) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [(2Z)-2-[(2S,3S,6R)-6-methyl-3-propan-2-yl-2-trimethylsilyloxycyclohexylidene]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2Z)-2-[(2S,3S,6R)-6-methyl-3-propan-2-yl-2-trimethylsilyloxycyclohexylidene]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135025648 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(2Z)-2-[(2S,3S,6R)-6-methyl-3-propan-2-yl-2-trimethylsilyloxycyclohexylidene]ethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)/C(=C/COC(=O)C(C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-14(2)16-11-10-15(3)17(18(16)23-24(7,8)9)12-13-22-19(21)20(4,5)6/h12,14-16,18H,10-11,13H2,1-9H3/b17-12-/t15-,16+,18+/m1/s1 |
| InChIKey | GBXIPOIAHWGRMS-GBIZAXDQSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|