C46H48O4 — CID 135025762
[5-[(2S,4S,5S)-2,5-dicyclohexyl-4-(4-phenylphenyl)-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate (PubChem CID 135025762) has the molecular formula C46H48O4 and a molecular weight of 664.89 g/mol. Its IUPAC name is [5-[(2S,4S,5S)-2,5-dicyclohexyl-4-(4-phenylphenyl)-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate.
| Compound Name | [5-[(2S,4S,5S)-2,5-dicyclohexyl-4-(4-phenylphenyl)-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate |
|---|---|
| PubChem CID | 135025762 |
| Molecular Formula | C46H48O4 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.36 |
| IUPAC Name | [5-[(2S,4S,5S)-2,5-dicyclohexyl-4-(4-phenylphenyl)-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate |
| SMILES | O=C(OC1=C(c2ccccc2)CCC([C@@]2(c3ccc(-c4ccccc4)cc3)O[C@@H](C3CCCCC3)O[C@H]2C2CCCCC2)=C1)c1ccccc1 |
| InChI | InChI=1S/C46H48O4/c47-44(37-22-12-4-13-23-37)48-42-32-40(30-31-41(42)35-18-8-2-9-19-35)46(39-28-26-34(27-29-39)33-16-6-1-7-17-33)43(36-20-10-3-11-21-36)49-45(50-46)38-24-14-5-15-25-38/h1-2,4,6-9,12-13,16-19,22-23,26-29,32,36,38,43,45H,3,5,10-11,14-15,20-21,24-25,30-31H2/t43-,45-,46+/m0/s1 |
| InChIKey | OUWYBKWPBBTQLE-DNPXFVMRSA-N |
| XLogP | 11.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |