C28H52O7Si — CID 135025771
(1R,3S,7R,8R,9S,13S,14R,17R)-13-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-17-triethylsilyloxy-6,18-dioxatricyclo[12.3.1.03,7]octadecan-5-one (PubChem CID 135025771) has the molecular formula C28H52O7Si and a molecular weight of 528.80 g/mol. Its IUPAC name is (1R,3S,7R,8R,9S,13S,14R,17R)-13-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-17-triethylsilyloxy-6,18-dioxatricyclo[12.3.1.03,7]octadecan-5-one.
| Compound Name | (1R,3S,7R,8R,9S,13S,14R,17R)-13-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-17-triethylsilyloxy-6,18-dioxatricyclo[12.3.1.03,7]octadecan-5-one |
|---|---|
| PubChem CID | 135025771 |
| Molecular Formula | C28H52O7Si |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | (1R,3S,7R,8R,9S,13S,14R,17R)-13-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-17-triethylsilyloxy-6,18-dioxatricyclo[12.3.1.03,7]octadecan-5-one |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@H]2O[C@@H]1C[C@H]1CC(=O)O[C@H]1[C@H](OCOC)[C@@H](C)CCC[C@]2(C)OC |
| InChI | InChI=1S/C28H52O7Si/c1-9-36(10-2,11-3)35-28(6)16-14-22-27(5,31-8)15-12-13-20(4)25(32-19-30-7)26-21(17-23(28)33-22)18-24(29)34-26/h20-23,25-26H,9-19H2,1-8H3/t20-,21-,22+,23+,25+,26+,27-,28+/m0/s1 |
| InChIKey | CSNGYQJYNPGMCS-NCTFSDQXSA-N |
| XLogP | 5.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|