About CID 135026025
CID 135026025 (PubChem CID 135026025) has the molecular formula C11H14N8
and a molecular weight of 258.29 g/mol.
Molecular Properties
| Compound Name | CID 135026025 |
| PubChem CID | 135026025 |
| Molecular Formula | C11H14N8 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | — |
| SMILES | Cn1cc(CN2[C]N(Cc3cn(C)nn3)C=C2)nn1 |
| InChI | InChI=1S/C11H14N8/c1-16-5-10(12-14-16)7-18-3-4-19(9-18)8-11-6-17(2)15-13-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | FVZWWQQSYOHWHB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 135026025 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135026025?
The IUPAC name of CID 135026025 (CID 135026025) is not available.
What is the SMILES notation for CID 135026025?
The canonical SMILES for CID 135026025 is Cn1cc(CN2[C]N(Cc3cn(C)nn3)C=C2)nn1.
What is the InChIKey of CID 135026025?
The InChIKey is FVZWWQQSYOHWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N8/c1-16-5-10(12-14-16)7-18-3-4-19(9-18)8-11-6-17(2)15-13-11/h3-6H,7-8H2,1-2H3.
What are the key properties of CID 135026025?
CID 135026025 has a molecular weight of 258.29 g/mol, XLogP of -0.27, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135026025 is sourced from PubChem (CID 135026025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).