C19H25NO5 — CID 135026140
1-O-benzyl 2-O-methyl (2R)-5-ethoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 135026140) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2R)-5-ethoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2R)-5-ethoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135026140 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2R)-5-ethoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCC1C[C@H](C(=O)OC)N(C(=O)OCc2ccccc2)C1OCC |
| InChI | InChI=1S/C19H25NO5/c1-4-9-15-12-16(18(21)23-3)20(17(15)24-5-2)19(22)25-13-14-10-7-6-8-11-14/h4,6-8,10-11,15-17H,1,5,9,12-13H2,2-3H3/t15?,16-,17?/m1/s1 |
| InChIKey | OXZRHVJWKCEFFZ-AQFXKWCLSA-N |
| XLogP | 3.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|