About (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone
(8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone (PubChem CID 135026260) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone |
| PubChem CID | 135026260 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone |
| SMILES | CC1CCC2(CC1)NN=C(C(=O)c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C22H24N2O/c1-16-12-14-22(15-13-16)19(17-8-4-2-5-9-17)20(23-24-22)21(25)18-10-6-3-7-11-18/h2-11,16,19,24H,12-15H2,1H3 |
| InChIKey | UJCPBBLBRDMYHU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone?
The IUPAC name of (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone (CID 135026260) is (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone.
What is the SMILES notation for (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone?
The canonical SMILES for (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone is CC1CCC2(CC1)NN=C(C(=O)c1ccccc1)C2c1ccccc1.
What is the InChIKey of (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone?
The InChIKey is UJCPBBLBRDMYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O/c1-16-12-14-22(15-13-16)19(17-8-4-2-5-9-17)20(23-24-22)21(25)18-10-6-3-7-11-18/h2-11,16,19,24H,12-15H2,1H3.
What are the key properties of (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone?
(8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone has a molecular weight of 332.45 g/mol, XLogP of 4.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-4-phenyl-1,2-diazaspiro[4.5]dec-2-en-3-yl)-phenylmethanone is sourced from PubChem (CID 135026260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).