C23H25N4O4P — CID 135026343
ethyl 4-(2-ethoxy-2-oxo-5-phenylimino-1,2λ5-azaphosphol-1-yl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 135026343) has the molecular formula C23H25N4O4P and a molecular weight of 452.45 g/mol. Its IUPAC name is ethyl 4-(2-ethoxy-2-oxo-5-phenylimino-1,2λ5-azaphosphol-1-yl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 4-(2-ethoxy-2-oxo-5-phenylimino-1,2λ5-azaphosphol-1-yl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135026343 |
| Molecular Formula | C23H25N4O4P |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | ethyl 4-(2-ethoxy-2-oxo-5-phenylimino-1,2λ5-azaphosphol-1-yl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)CC1N1/C(=N/c2ccccc2)C=CP1(=O)OCC |
| InChI | InChI=1S/C23H25N4O4P/c1-3-30-23(28)22-20(17-26(25-22)19-13-9-6-10-14-19)27-21(15-16-32(27,29)31-4-2)24-18-11-7-5-8-12-18/h5-16,20H,3-4,17H2,1-2H3/b24-21+ |
| InChIKey | IAHLFSBPYRCRKW-DARPEHSRSA-N |
| XLogP | 4.58 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|