About [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate
[(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate (PubChem CID 135026428) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate |
| PubChem CID | 135026428 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC(C)=O)C=C[C@@H]1O |
| InChI | InChI=1S/C10H14O5/c1-6(11)14-8-3-4-9(13)10(5-8)15-7(2)12/h3-4,8-10,13H,5H2,1-2H3/t8-,9-,10-/m0/s1 |
| InChIKey | DIFVWRAMCHPRRX-GUBZILKMSA-N |
| XLogP | 0.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate?
The IUPAC name of [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate (CID 135026428) is [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate.
What is the SMILES notation for [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate?
The canonical SMILES for [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate is CC(=O)O[C@H]1C[C@@H](OC(C)=O)C=C[C@@H]1O.
What is the InChIKey of [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate?
The InChIKey is DIFVWRAMCHPRRX-GUBZILKMSA-N. The full InChI is InChI=1S/C10H14O5/c1-6(11)14-8-3-4-9(13)10(5-8)15-7(2)12/h3-4,8-10,13H,5H2,1-2H3/t8-,9-,10-/m0/s1.
What are the key properties of [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate?
[(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate has a molecular weight of 214.22 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S,5S)-5-acetyloxy-4-hydroxycyclohex-2-en-1-yl] acetate is sourced from PubChem (CID 135026428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).