About 1-ethoxy-N,N-dimethylmethanamine;rutherfordium
1-ethoxy-N,N-dimethylmethanamine;rutherfordium (PubChem CID 135026443) has the molecular formula C5H12NORf-
and a molecular weight of 369.16 g/mol. Its IUPAC name is 1-ethoxy-N,N-dimethylmethanamine;rutherfordium.
Molecular Properties
| Compound Name | 1-ethoxy-N,N-dimethylmethanamine;rutherfordium |
| PubChem CID | 135026443 |
| Molecular Formula | C5H12NORf- |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-ethoxy-N,N-dimethylmethanamine;rutherfordium |
| SMILES | CCO[CH-]N(C)C.[Rf] |
| InChI | InChI=1S/C5H12NO.Rf/c1-4-7-5-6(2)3;/h5H,4H2,1-3H3;/q-1; |
| InChIKey | IZIDYDCLFMQYAY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-N,N-dimethylmethanamine;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-N,N-dimethylmethanamine;rutherfordium?
The IUPAC name of 1-ethoxy-N,N-dimethylmethanamine;rutherfordium (CID 135026443) is 1-ethoxy-N,N-dimethylmethanamine;rutherfordium.
What is the SMILES notation for 1-ethoxy-N,N-dimethylmethanamine;rutherfordium?
The canonical SMILES for 1-ethoxy-N,N-dimethylmethanamine;rutherfordium is CCO[CH-]N(C)C.[Rf].
What is the InChIKey of 1-ethoxy-N,N-dimethylmethanamine;rutherfordium?
The InChIKey is IZIDYDCLFMQYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12NO.Rf/c1-4-7-5-6(2)3;/h5H,4H2,1-3H3;/q-1;.
What are the key properties of 1-ethoxy-N,N-dimethylmethanamine;rutherfordium?
1-ethoxy-N,N-dimethylmethanamine;rutherfordium has a molecular weight of 369.16 g/mol, XLogP of 0.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-N,N-dimethylmethanamine;rutherfordium is sourced from PubChem (CID 135026443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).