C27H27NO6 — CID 135026445
pentyl (3R,4S)-1-benzyl-4-(6-methyl-4-oxochromen-3-yl)-2,5-dioxopyrrolidine-3-carboxylate (PubChem CID 135026445) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is pentyl (3R,4S)-1-benzyl-4-(6-methyl-4-oxochromen-3-yl)-2,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | pentyl (3R,4S)-1-benzyl-4-(6-methyl-4-oxochromen-3-yl)-2,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 135026445 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | pentyl (3R,4S)-1-benzyl-4-(6-methyl-4-oxochromen-3-yl)-2,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCCCCOC(=O)[C@H]1C(=O)N(Cc2ccccc2)C(=O)[C@@H]1c1coc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C27H27NO6/c1-3-4-8-13-33-27(32)23-22(20-16-34-21-12-11-17(2)14-19(21)24(20)29)25(30)28(26(23)31)15-18-9-6-5-7-10-18/h5-7,9-12,14,16,22-23H,3-4,8,13,15H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | QFSJDLYBUGXSOI-DHIUTWEWSA-N |
| XLogP | 4.10 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|