About [(2S)-pent-4-en-2-yl] acetate
[(2S)-pent-4-en-2-yl] acetate (PubChem CID 135026764) has the molecular formula C7H11O2+
and a molecular weight of 127.16 g/mol. Its IUPAC name is [(2S)-pent-4-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-pent-4-en-2-yl] acetate |
| PubChem CID | 135026764 |
| Molecular Formula | C7H11O2+ |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | [(2S)-pent-4-en-2-yl] acetate |
| SMILES | C=C[CH+][C@H](C)OC(C)=O |
| InChI | InChI=1S/C7H11O2/c1-4-5-6(2)9-7(3)8/h4-6H,1H2,2-3H3/q+1/t6-/m0/s1 |
| InChIKey | DAFYDSUAVFFVGO-LURJTMIESA-N |
| XLogP | 1.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-pent-4-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-pent-4-en-2-yl] acetate?
The IUPAC name of [(2S)-pent-4-en-2-yl] acetate (CID 135026764) is [(2S)-pent-4-en-2-yl] acetate.
What is the SMILES notation for [(2S)-pent-4-en-2-yl] acetate?
The canonical SMILES for [(2S)-pent-4-en-2-yl] acetate is C=C[CH+][C@H](C)OC(C)=O.
What is the InChIKey of [(2S)-pent-4-en-2-yl] acetate?
The InChIKey is DAFYDSUAVFFVGO-LURJTMIESA-N. The full InChI is InChI=1S/C7H11O2/c1-4-5-6(2)9-7(3)8/h4-6H,1H2,2-3H3/q+1/t6-/m0/s1.
What are the key properties of [(2S)-pent-4-en-2-yl] acetate?
[(2S)-pent-4-en-2-yl] acetate has a molecular weight of 127.16 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-pent-4-en-2-yl] acetate is sourced from PubChem (CID 135026764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).