C28H33F3N2O5S — CID 135026779
tert-butyl (3E)-3-[(3S)-3-[[(S)-tert-butylsulfinyl]amino]-4,4,4-trifluoro-1-(4-methoxyphenyl)butylidene]-2-oxoindole-1-carboxylate (PubChem CID 135026779) has the molecular formula C28H33F3N2O5S and a molecular weight of 566.64 g/mol. Its IUPAC name is tert-butyl (3E)-3-[(3S)-3-[[(S)-tert-butylsulfinyl]amino]-4,4,4-trifluoro-1-(4-methoxyphenyl)butylidene]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-[(3S)-3-[[(S)-tert-butylsulfinyl]amino]-4,4,4-trifluoro-1-(4-methoxyphenyl)butylidene]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 135026779 |
| Molecular Formula | C28H33F3N2O5S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | tert-butyl (3E)-3-[(3S)-3-[[(S)-tert-butylsulfinyl]amino]-4,4,4-trifluoro-1-(4-methoxyphenyl)butylidene]-2-oxoindole-1-carboxylate |
| SMILES | COc1ccc(/C(C[C@H](N[S@@](=O)C(C)(C)C)C(F)(F)F)=C2/C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H33F3N2O5S/c1-26(2,3)38-25(35)33-21-11-9-8-10-19(21)23(24(33)34)20(17-12-14-18(37-7)15-13-17)16-22(28(29,30)31)32-39(36)27(4,5)6/h8-15,22,32H,16H2,1-7H3/b23-20+/t22-,39-/m0/s1 |
| InChIKey | IBYQEHITXNTSEU-RWFKSFLVSA-N |
| XLogP | 6.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|